N-(Isobutoxymethyl)Acrylamide
Catalog No: FT-0693651
CAS No: 16669-59-3
- Chemical Name: N-(Isobutoxymethyl)Acrylamide
- Molecular Formula: C8H15NO2
- Molecular Weight: 157.21
- InChI Key: KCTMTGOHHMRJHZ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H15NO2/c1-4-8(10)9-6-11-5-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07, GHS08 |
|---|---|
| CAS: | 16669-59-3 |
| Flash_Point: | 175 °F |
| Product_Name: | N-(2-methylpropoxymethyl)prop-2-enamide |
| Bolling_Point: | 108ºC(lit.) |
| FW: | 157.21000 |
| Melting_Point: | N/A |
| MF: | C8H15NO2 |
| Density: | 0.97 g/mL at 25ºC(lit.) |
| Refractive_Index: | 1.461 |
|---|---|
| Vapor_Pressure: | 0.00562mmHg at 25°C |
| Flash_Point: | 175 °F |
| LogP: | 1.30960 |
| Bolling_Point: | 108ºC(lit.) |
| FW: | 157.21000 |
| PSA: | 38.33000 |
| Computational_Chemistry: | ['1. XlogP :14 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :5 ', '5. Isotope Atom Count :2 ', '6. TPSA 383 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :132 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C8H15NO2 |
| Exact_Mass: | 157.11000 |
| Molecular_Structure: | ['1 . Molar refractive index 4420 ', '2 . Molar volume （m3/mol）1679 ', '3 . Parachor （902K）3921 ', '4 . Surface tension 296 ', '5 . Polarizability 1752'] |
| Density: | 0.97 g/mL at 25ºC(lit.) |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）097g/mLat 25°C(lit)3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）108°C(lit) ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexn 20/D 1461(lit)8. Flash point（ºC）175°F9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS05, GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R21/22 |
| HS_Code: | 2924199090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RTECS: | AS3630000 |
| RIDADR: | UN 2810 6 |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P201-P260-P280-P301 + P312 + P330-P305 + P351 + P338 + P310-P308 + P313 |
| Safety_Statements: | H302 + H312-H315-H317-H318-H340-H350-H361-H373 |
